C35H54N2O5 — CID 90206275
[(3R,4R,6aR,6bS,8aR,11R,12S,14bS)-4-(2-formamidoethylcarbamoyl)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-3-yl] acetate (PubChem CID 90206275) has the molecular formula C35H54N2O5 and a molecular weight of 582.83 g/mol. Its IUPAC name is [(3R,4R,6aR,6bS,8aR,11R,12S,14bS)-4-(2-formamidoethylcarbamoyl)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-3-yl] acetate.
| Compound Name | [(3R,4R,6aR,6bS,8aR,11R,12S,14bS)-4-(2-formamidoethylcarbamoyl)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-3-yl] acetate |
|---|---|
| PubChem CID | 90206275 |
| Molecular Formula | C35H54N2O5 |
| Molecular Weight | 582.83 g/mol |
| Exact Mass | 582.40 |
| IUPAC Name | [(3R,4R,6aR,6bS,8aR,11R,12S,14bS)-4-(2-formamidoethylcarbamoyl)-4,6a,6b,8a,11,12,14b-heptamethyl-14-oxo-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14a-tetradecahydropicen-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@]2(C)C(CC[C@]3(C)C2C(=O)C=C2C4[C@@H](C)[C@H](C)CC[C@]4(C)CC[C@]23C)[C@@]1(C)C(=O)NCCNC=O |
| InChI | InChI=1S/C35H54N2O5/c1-21-9-12-31(4)15-16-33(6)24(28(31)22(21)2)19-25(40)29-32(5)13-11-27(42-23(3)39)35(8,26(32)10-14-34(29,33)7)30(41)37-18-17-36-20-38/h19-22,26-29H,9-18H2,1-8H3,(H,36,38)(H,37,41)/t21-,22+,26?,27-,28?,29?,31-,32+,33-,34-,35-/m1/s1 |
| InChIKey | NIMUWALPSYTGBE-PBFJPQAASA-N |
| XLogP | 5.62 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.83 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|