C24H21ClN2O2S — CID 90208398
1-(2-chloro-1,3,4,5-tetrahydro-[1]benzothiolo[3,2-c]azepin-9-yl)-4-phenylmethoxypyridin-2-one (PubChem CID 90208398) has the molecular formula C24H21ClN2O2S and a molecular weight of 436.96 g/mol. Its IUPAC name is 1-(2-chloro-1,3,4,5-tetrahydro-[1]benzothiolo[3,2-c]azepin-9-yl)-4-phenylmethoxypyridin-2-one.
| Compound Name | 1-(2-chloro-1,3,4,5-tetrahydro-[1]benzothiolo[3,2-c]azepin-9-yl)-4-phenylmethoxypyridin-2-one |
|---|---|
| PubChem CID | 90208398 |
| Molecular Formula | C24H21ClN2O2S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-(2-chloro-1,3,4,5-tetrahydro-[1]benzothiolo[3,2-c]azepin-9-yl)-4-phenylmethoxypyridin-2-one |
| SMILES | O=c1cc(OCc2ccccc2)ccn1-c1ccc2sc3c(c2c1)CN(Cl)CCC3 |
| InChI | InChI=1S/C24H21ClN2O2S/c25-26-11-4-7-22-21(15-26)20-13-18(8-9-23(20)30-22)27-12-10-19(14-24(27)28)29-16-17-5-2-1-3-6-17/h1-3,5-6,8-10,12-14H,4,7,11,15-16H2 |
| InChIKey | VCDUGXIYSNSISP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|