C30H25FN4O4 — CID 90209834
4-[(Z)-1-(4-fluorophenyl)-3-oxo-1-[[1-(2-pyrazol-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]but-1-en-2-yl]benzoic acid (PubChem CID 90209834) has the molecular formula C30H25FN4O4 and a molecular weight of 524.55 g/mol. Its IUPAC name is 4-[(Z)-1-(4-fluorophenyl)-3-oxo-1-[[1-(2-pyrazol-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]but-1-en-2-yl]benzoic acid.
| Compound Name | 4-[(Z)-1-(4-fluorophenyl)-3-oxo-1-[[1-(2-pyrazol-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]but-1-en-2-yl]benzoic acid |
|---|---|
| PubChem CID | 90209834 |
| Molecular Formula | C30H25FN4O4 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 4-[(Z)-1-(4-fluorophenyl)-3-oxo-1-[[1-(2-pyrazol-1-ylacetyl)-2,3-dihydroindol-5-yl]amino]but-1-en-2-yl]benzoic acid |
| SMILES | CC(=O)/C(=C(\Nc1ccc2c(c1)CCN2C(=O)Cn1cccn1)c1ccc(F)cc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C30H25FN4O4/c1-19(36)28(20-3-5-22(6-4-20)30(38)39)29(21-7-9-24(31)10-8-21)33-25-11-12-26-23(17-25)13-16-35(26)27(37)18-34-15-2-14-32-34/h2-12,14-15,17,33H,13,16,18H2,1H3,(H,38,39)/b29-28+ |
| InChIKey | MGGJACPPLOBBPQ-ZQHSETAFSA-N |
| XLogP | 4.88 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|