C18H30FN7O2 — CID 90212063
3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]propanamide (PubChem CID 90212063) has the molecular formula C18H30FN7O2 and a molecular weight of 395.48 g/mol. Its IUPAC name is 3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]propanamide.
| Compound Name | 3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 90212063 |
| Molecular Formula | C18H30FN7O2 |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(1-methylpiperidin-4-yl)oxy-3-pyridinyl]propanamide |
| SMILES | CN1CCC(Oc2ccncc2NC(=O)C(C(N)N)C2NCC(F)CN2)CC1 |
| InChI | InChI=1S/C18H30FN7O2/c1-26-6-3-12(4-7-26)28-14-2-5-22-10-13(14)25-18(27)15(16(20)21)17-23-8-11(19)9-24-17/h2,5,10-12,15-17,23-24H,3-4,6-9,20-21H2,1H3,(H,25,27) |
| InChIKey | UGUAQQIKCCKJMH-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 130.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|