C15H23FN6O3 — CID 90211982
3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(oxetan-3-yloxy)-3-pyridinyl]propanamide (PubChem CID 90211982) has the molecular formula C15H23FN6O3 and a molecular weight of 354.39 g/mol. Its IUPAC name is 3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(oxetan-3-yloxy)-3-pyridinyl]propanamide.
| Compound Name | 3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(oxetan-3-yloxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 90211982 |
| Molecular Formula | C15H23FN6O3 |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 3,3-diamino-2-(5-fluoro-1,3-diazinan-2-yl)-N-[4-(oxetan-3-yloxy)-3-pyridinyl]propanamide |
| SMILES | NC(N)C(C(=O)Nc1cnccc1OC1COC1)C1NCC(F)CN1 |
| InChI | InChI=1S/C15H23FN6O3/c16-8-3-20-14(21-4-8)12(13(17)18)15(23)22-10-5-19-2-1-11(10)25-9-6-24-7-9/h1-2,5,8-9,12-14,20-21H,3-4,6-7,17-18H2,(H,22,23) |
| InChIKey | HEXMYZADUZBMRI-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|