C16H22F3N7O2 — CID 90212253
3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide (PubChem CID 90212253) has the molecular formula C16H22F3N7O2 and a molecular weight of 401.39 g/mol. Its IUPAC name is 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide.
| Compound Name | 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 90212253 |
| Molecular Formula | C16H22F3N7O2 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 3,3-diamino-2-[5-(cyanomethyl)-1,3-diazinan-2-yl]-N-[4-(2,2,2-trifluoroethoxy)-3-pyridinyl]propanamide |
| SMILES | N#CCC1CNC(C(C(=O)Nc2cnccc2OCC(F)(F)F)C(N)N)NC1 |
| InChI | InChI=1S/C16H22F3N7O2/c17-16(18,19)8-28-11-2-4-23-7-10(11)26-15(27)12(13(21)22)14-24-5-9(1-3-20)6-25-14/h2,4,7,9,12-14,24-25H,1,5-6,8,21-22H2,(H,26,27) |
| InChIKey | YDSBODFJPQFJFP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 151.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|