C11H12N6 — CID 90213626
1,2,3-trimethyl-6-(2H-tetrazol-5-yl)pyrrolo[3,2-c]pyridine (PubChem CID 90213626) has the molecular formula C11H12N6 and a molecular weight of 228.26 g/mol. Its IUPAC name is 1,2,3-trimethyl-6-(2H-tetrazol-5-yl)pyrrolo[3,2-c]pyridine.
| Compound Name | 1,2,3-trimethyl-6-(2H-tetrazol-5-yl)pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 90213626 |
| Molecular Formula | C11H12N6 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1,2,3-trimethyl-6-(2H-tetrazol-5-yl)pyrrolo[3,2-c]pyridine |
| SMILES | Cc1c(C)n(C)c2cc(-c3nn[nH]n3)ncc12 |
| InChI | InChI=1S/C11H12N6/c1-6-7(2)17(3)10-4-9(12-5-8(6)10)11-13-15-16-14-11/h4-5H,1-3H3,(H,13,14,15,16) |
| InChIKey | XLOUFUJVWJVYJR-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |