About azanium;morpholine;nitrate
azanium;morpholine;nitrate (PubChem CID 90214442) has the molecular formula C4H13N3O4
and a molecular weight of 167.16 g/mol. Its IUPAC name is azanium;morpholine;nitrate.
Molecular Properties
| Compound Name | azanium;morpholine;nitrate |
| PubChem CID | 90214442 |
| Molecular Formula | C4H13N3O4 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | azanium;morpholine;nitrate |
| SMILES | C1COCCN1.O=[N+]([O-])[O-].[NH4+] |
| InChI | InChI=1S/C4H9NO.NO3.H3N/c1-3-6-4-2-5-1;2-1(3)4;/h5H,1-4H2;;1H3/q;-1;/p+1 |
| InChIKey | HPFGIMJTHHVIES-UHFFFAOYSA-O |
| XLogP | -0.26 |
| TPSA | 123.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azanium;morpholine;nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;morpholine;nitrate?
The IUPAC name of azanium;morpholine;nitrate (CID 90214442) is azanium;morpholine;nitrate.
What is the SMILES notation for azanium;morpholine;nitrate?
The canonical SMILES for azanium;morpholine;nitrate is C1COCCN1.O=[N+]([O-])[O-].[NH4+].
What is the InChIKey of azanium;morpholine;nitrate?
The InChIKey is HPFGIMJTHHVIES-UHFFFAOYSA-O. The full InChI is InChI=1S/C4H9NO.NO3.H3N/c1-3-6-4-2-5-1;2-1(3)4;/h5H,1-4H2;;1H3/q;-1;/p+1.
What are the key properties of azanium;morpholine;nitrate?
azanium;morpholine;nitrate has a molecular weight of 167.16 g/mol, XLogP of -0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;morpholine;nitrate is sourced from PubChem (CID 90214442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).