C31H42F2N2O3 — CID 90215460
(3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoyl]henicosa-3,6,9,12,15,18-hexaenamide (PubChem CID 90215460) has the molecular formula C31H42F2N2O3 and a molecular weight of 528.68 g/mol. Its IUPAC name is (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoyl]henicosa-3,6,9,12,15,18-hexaenamide.
| Compound Name | (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoyl]henicosa-3,6,9,12,15,18-hexaenamide |
|---|---|
| PubChem CID | 90215460 |
| Molecular Formula | C31H42F2N2O3 |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | (3Z,6Z,9Z,12Z,15Z,18Z)-N-[2-[(4S)-4-(2,2-difluoroethenyl)-2-oxopyrrolidin-1-yl]butanoyl]henicosa-3,6,9,12,15,18-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC(=O)NC(=O)C(CC)N1C[C@H](C=C(F)F)CC1=O |
| InChI | InChI=1S/C31H42F2N2O3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(36)34-31(38)27(4-2)35-25-26(23-28(32)33)24-30(35)37/h5-6,8-9,11-12,14-15,17-18,20-21,23,26-27H,3-4,7,10,13,16,19,22,24-25H2,1-2H3,(H,34,36,38)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20-/t26-,27?/m1/s1 |
| InChIKey | MRXQTTJWRUGPJT-AGJAJOOOSA-N |
| XLogP | 7.12 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|