C21H19F6N3O4S — CID 90217577
(8R,9aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4,5,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-7-one (PubChem CID 90217577) has the molecular formula C21H19F6N3O4S and a molecular weight of 523.46 g/mol. Its IUPAC name is (8R,9aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4,5,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-7-one.
| Compound Name | (8R,9aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4,5,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-7-one |
|---|---|
| PubChem CID | 90217577 |
| Molecular Formula | C21H19F6N3O4S |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (8R,9aS)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-3,4,5,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-7-one |
| SMILES | O=C1[C@H](Oc2ccc(C(F)(F)F)cn2)C[C@H]2CN(S(=O)(=O)c3ccc(C(F)(F)F)cc3)CCCN12 |
| InChI | InChI=1S/C21H19F6N3O4S/c22-20(23,24)13-2-5-16(6-3-13)35(32,33)29-8-1-9-30-15(12-29)10-17(19(30)31)34-18-7-4-14(11-28-18)21(25,26)27/h2-7,11,15,17H,1,8-10,12H2/t15-,17+/m0/s1 |
| InChIKey | XRLJHAOHRRLLBX-DOTOQJQBSA-N |
| XLogP | 3.56 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |