C21H19F6N3O4S — CID 90217595
(8R,9aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-5-one (PubChem CID 90217595) has the molecular formula C21H19F6N3O4S and a molecular weight of 523.46 g/mol. Its IUPAC name is (8R,9aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-5-one.
| Compound Name | (8R,9aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-5-one |
|---|---|
| PubChem CID | 90217595 |
| Molecular Formula | C21H19F6N3O4S |
| Molecular Weight | 523.46 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (8R,9aR)-2-[4-(trifluoromethyl)phenyl]sulfonyl-8-[[6-(trifluoromethyl)-3-pyridinyl]oxy]-3,4,7,8,9,9a-hexahydro-1H-pyrrolo[1,2-a][1,4]diazepin-5-one |
| SMILES | O=C1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)C[C@H]2C[C@@H](Oc3ccc(C(F)(F)F)nc3)CN12 |
| InChI | InChI=1S/C21H19F6N3O4S/c22-20(23,24)13-1-4-17(5-2-13)35(32,33)29-8-7-19(31)30-12-16(9-14(30)11-29)34-15-3-6-18(28-10-15)21(25,26)27/h1-6,10,14,16H,7-9,11-12H2/t14-,16-/m1/s1 |
| InChIKey | RFTIIRUEFJUYRV-GDBMZVCRSA-N |
| XLogP | 3.56 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |