C17H16F5N3O3S — CID 133424223
1-[5-(difluoromethoxy)-2-pyridinyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine (PubChem CID 133424223) has the molecular formula C17H16F5N3O3S and a molecular weight of 437.39 g/mol. Its IUPAC name is 1-[5-(difluoromethoxy)-2-pyridinyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine.
| Compound Name | 1-[5-(difluoromethoxy)-2-pyridinyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 133424223 |
| Molecular Formula | C17H16F5N3O3S |
| Molecular Weight | 437.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 1-[5-(difluoromethoxy)-2-pyridinyl]-4-[4-(trifluoromethyl)phenyl]sulfonylpiperazine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)cc1)N1CCN(c2ccc(OC(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H16F5N3O3S/c18-16(19)28-13-3-6-15(23-11-13)24-7-9-25(10-8-24)29(26,27)14-4-1-12(2-5-14)17(20,21)22/h1-6,11,16H,7-10H2 |
| InChIKey | NMXQPPJOPRFOQW-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |