C20H22F3N3O4S — CID 135160185
[5-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-2-yl]methanediol (PubChem CID 135160185) has the molecular formula C20H22F3N3O4S and a molecular weight of 457.47 g/mol. Its IUPAC name is [5-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-2-yl]methanediol.
| Compound Name | [5-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-2-yl]methanediol |
|---|---|
| PubChem CID | 135160185 |
| Molecular Formula | C20H22F3N3O4S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | [5-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-2-yl]methanediol |
| SMILES | O=S(=O)(c1ccc2c(c1)CC(C(O)O)C2)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C20H22F3N3O4S/c21-20(22,23)16-2-4-18(24-12-16)25-5-7-26(8-6-25)31(29,30)17-3-1-13-9-15(19(27)28)10-14(13)11-17/h1-4,11-12,15,19,27-28H,5-10H2 |
| InChIKey | ZBFUBAQNPNQDPD-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|