C21H22F4N2O4S — CID 135160334
[6-[4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-1-yl]methanediol (PubChem CID 135160334) has the molecular formula C21H22F4N2O4S and a molecular weight of 474.48 g/mol. Its IUPAC name is [6-[4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-1-yl]methanediol.
| Compound Name | [6-[4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-1-yl]methanediol |
|---|---|
| PubChem CID | 135160334 |
| Molecular Formula | C21H22F4N2O4S |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | [6-[4-[2-fluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]sulfonyl-2,3-dihydro-1H-inden-1-yl]methanediol |
| SMILES | O=S(=O)(c1ccc2c(c1)C(C(O)O)CC2)N1CCN(c2ccc(C(F)(F)F)cc2F)CC1 |
| InChI | InChI=1S/C21H22F4N2O4S/c22-18-11-14(21(23,24)25)3-6-19(18)26-7-9-27(10-8-26)32(30,31)15-4-1-13-2-5-16(20(28)29)17(13)12-15/h1,3-4,6,11-12,16,20,28-29H,2,5,7-10H2 |
| InChIKey | HMJMMLPGFMRCAY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|