C28H25N5O — CID 90221196
N-[(2S)-2-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethyl]benzamide (PubChem CID 90221196) has the molecular formula C28H25N5O and a molecular weight of 447.54 g/mol. Its IUPAC name is N-[(2S)-2-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethyl]benzamide.
| Compound Name | N-[(2S)-2-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethyl]benzamide |
|---|---|
| PubChem CID | 90221196 |
| Molecular Formula | C28H25N5O |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-[(2S)-2-[[5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethyl]benzamide |
| SMILES | Cc1[nH]nc2ccc(-c3cncc(N[C@H](CNC(=O)c4ccccc4)c4ccccc4)c3)cc12 |
| InChI | InChI=1S/C28H25N5O/c1-19-25-15-22(12-13-26(25)33-32-19)23-14-24(17-29-16-23)31-27(20-8-4-2-5-9-20)18-30-28(34)21-10-6-3-7-11-21/h2-17,27,31H,18H2,1H3,(H,30,34)(H,32,33)/t27-/m1/s1 |
| InChIKey | FIRIZHOUINYUHV-HHHXNRCGSA-N |
| XLogP | 5.52 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |