C21H20N4OS — CID 90220836
2-[[5-(3-methylsulfanyl-1H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethanol (PubChem CID 90220836) has the molecular formula C21H20N4OS and a molecular weight of 376.49 g/mol. Its IUPAC name is 2-[[5-(3-methylsulfanyl-1H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethanol.
| Compound Name | 2-[[5-(3-methylsulfanyl-1H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 90220836 |
| Molecular Formula | C21H20N4OS |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-[[5-(3-methylsulfanyl-1H-indazol-5-yl)-3-pyridinyl]amino]-2-phenylethanol |
| SMILES | CSc1n[nH]c2ccc(-c3cncc(NC(CO)c4ccccc4)c3)cc12 |
| InChI | InChI=1S/C21H20N4OS/c1-27-21-18-10-15(7-8-19(18)24-25-21)16-9-17(12-22-11-16)23-20(13-26)14-5-3-2-4-6-14/h2-12,20,23,26H,13H2,1H3,(H,24,25) |
| InChIKey | RPKQHVBCVVRYGS-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |