C10H22N2O — CID 90222280
6-imino-2,5-dimethyl-2-(methylamino)heptan-3-ol (PubChem CID 90222280) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is 6-imino-2,5-dimethyl-2-(methylamino)heptan-3-ol.
| Compound Name | 6-imino-2,5-dimethyl-2-(methylamino)heptan-3-ol |
|---|---|
| PubChem CID | 90222280 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 6-imino-2,5-dimethyl-2-(methylamino)heptan-3-ol |
| SMILES | [H]/N=C(\C)C(C)CC(O)C(C)(C)NC |
| InChI | InChI=1S/C10H22N2O/c1-7(8(2)11)6-9(13)10(3,4)12-5/h7,9,11-13H,6H2,1-5H3/b11-8+ |
| InChIKey | ILKHJFCMPWCERL-DHZHZOJOSA-N |
| XLogP | 1.41 |
| TPSA | 56.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|