C15H26N4O4 — CID 123935266
2-[[2-[(2-ethanimidoyl-3-iminobutanoyl)amino]-3,3-dimethylbutanoyl]amino]propanoic acid (PubChem CID 123935266) has the molecular formula C15H26N4O4 and a molecular weight of 326.40 g/mol. Its IUPAC name is 2-[[2-[(2-ethanimidoyl-3-iminobutanoyl)amino]-3,3-dimethylbutanoyl]amino]propanoic acid.
| Compound Name | 2-[[2-[(2-ethanimidoyl-3-iminobutanoyl)amino]-3,3-dimethylbutanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 123935266 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 2-[[2-[(2-ethanimidoyl-3-iminobutanoyl)amino]-3,3-dimethylbutanoyl]amino]propanoic acid |
| SMILES | [H]/N=C(\C)C(C(=O)NC(C(=O)NC(C)C(=O)O)C(C)(C)C)/C(C)=N/[H] |
| InChI | InChI=1S/C15H26N4O4/c1-7(16)10(8(2)17)12(20)19-11(15(4,5)6)13(21)18-9(3)14(22)23/h9-11,16-17H,1-6H3,(H,18,21)(H,19,20)(H,22,23)/b16-7+,17-8+ |
| InChIKey | GIVKSDWQGRSGLD-GDWCLCACSA-N |
| XLogP | 0.80 |
| TPSA | 143.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|