C8H15NO5 — CID 87703866
2-[(2,3-dihydroxy-3-methylbutanoyl)amino]propanoic acid (PubChem CID 87703866) has the molecular formula C8H15NO5 and a molecular weight of 205.21 g/mol. Its IUPAC name is 2-[(2,3-dihydroxy-3-methylbutanoyl)amino]propanoic acid.
| Compound Name | 2-[(2,3-dihydroxy-3-methylbutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 87703866 |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 2-[(2,3-dihydroxy-3-methylbutanoyl)amino]propanoic acid |
| SMILES | CC(NC(=O)C(O)C(C)(C)O)C(=O)O |
| InChI | InChI=1S/C8H15NO5/c1-4(7(12)13)9-6(11)5(10)8(2,3)14/h4-5,10,14H,1-3H3,(H,9,11)(H,12,13) |
| InChIKey | DWJHABAWTSPMEN-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |