C16H24FNOS — CID 90228223
N-ethyl-3-(4-fluorocyclohexyl)-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 90228223) has the molecular formula C16H24FNOS and a molecular weight of 297.44 g/mol. Its IUPAC name is N-ethyl-3-(4-fluorocyclohexyl)-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | N-ethyl-3-(4-fluorocyclohexyl)-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 90228223 |
| Molecular Formula | C16H24FNOS |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N-ethyl-3-(4-fluorocyclohexyl)-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CCN(Cc1cccs1)C(=O)CCC1CCC(F)CC1 |
| InChI | InChI=1S/C16H24FNOS/c1-2-18(12-15-4-3-11-20-15)16(19)10-7-13-5-8-14(17)9-6-13/h3-4,11,13-14H,2,5-10,12H2,1H3 |
| InChIKey | IOZFFTWTXOOVRG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |