C13H21N6O8P — CID 90228373
(2-amino-2,3-dihydroxypropyl) [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate (PubChem CID 90228373) has the molecular formula C13H21N6O8P and a molecular weight of 420.32 g/mol. Its IUPAC name is (2-amino-2,3-dihydroxypropyl) [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | (2-amino-2,3-dihydroxypropyl) [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 90228373 |
| Molecular Formula | C13H21N6O8P |
| Molecular Weight | 420.32 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | (2-amino-2,3-dihydroxypropyl) [(2R,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@H]1CC(O)[C@@H](COP(=O)(O)OCC(N)(O)CO)O1 |
| InChI | InChI=1S/C13H21N6O8P/c14-11-10-12(17-5-16-11)19(6-18-10)9-1-7(21)8(27-9)2-25-28(23,24)26-4-13(15,22)3-20/h5-9,20-22H,1-4,15H2,(H,23,24)(H2,14,16,17)/t7?,8-,9-,13?/m1/s1 |
| InChIKey | ADSVWMIATQXBHH-CNLDYIBBSA-N |
| XLogP | -2.17 |
| TPSA | 221.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.32 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|