C21H20Cl2F2N4OS — CID 90230390
N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-3-chloro-4-(4-chloro-1-ethylpyrazol-5-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide (PubChem CID 90230390) has the molecular formula C21H20Cl2F2N4OS and a molecular weight of 485.39 g/mol. Its IUPAC name is N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-3-chloro-4-(4-chloro-1-ethylpyrazol-5-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide.
| Compound Name | N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-3-chloro-4-(4-chloro-1-ethylpyrazol-5-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
|---|---|
| PubChem CID | 90230390 |
| Molecular Formula | C21H20Cl2F2N4OS |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | N-[(2S)-1-amino-3-(3,4-difluorophenyl)propan-2-yl]-3-chloro-4-(4-chloro-1-ethylpyrazol-5-yl)-6-sulfanylidenecyclohexa-1,3-diene-1-carboxamide |
| SMILES | CCn1ncc(Cl)c1C1=C(Cl)C=C(C(=O)N[C@H](CN)Cc2ccc(F)c(F)c2)C(=S)C1 |
| InChI | InChI=1S/C21H20Cl2F2N4OS/c1-2-29-20(16(23)10-27-29)13-8-19(31)14(7-15(13)22)21(30)28-12(9-26)5-11-3-4-17(24)18(25)6-11/h3-4,6-7,10,12H,2,5,8-9,26H2,1H3,(H,28,30)/t12-/m0/s1 |
| InChIKey | VFWWSTBYTDNURQ-LBPRGKRZSA-N |
| XLogP | 4.17 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|