C20H18ClF2IN4OS — CID 138568060
N-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-fluoro-9-iodo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide (PubChem CID 138568060) has the molecular formula C20H18ClF2IN4OS and a molecular weight of 562.81 g/mol. Its IUPAC name is N-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-fluoro-9-iodo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide.
| Compound Name | N-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-fluoro-9-iodo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 138568060 |
| Molecular Formula | C20H18ClF2IN4OS |
| Molecular Weight | 562.81 g/mol |
| Exact Mass | 561.99 |
| IUPAC Name | N-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-fluoro-9-iodo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
| SMILES | NCC(Cc1cccc(F)c1)NC(=O)c1cc2c(s1)C(F)(I)CCn1ncc(Cl)c1-2 |
| InChI | InChI=1S/C20H18ClF2IN4OS/c21-15-10-26-28-5-4-20(23,24)18-14(17(15)28)8-16(30-18)19(29)27-13(9-25)7-11-2-1-3-12(22)6-11/h1-3,6,8,10,13H,4-5,7,9,25H2,(H,27,29) |
| InChIKey | CZKAMSFFWRDMBB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.81 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|