C20H19ClFN5OS — CID 145417842
N'-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboximidamide (PubChem CID 145417842) has the molecular formula C20H19ClFN5OS and a molecular weight of 431.92 g/mol. Its IUPAC name is N'-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboximidamide.
| Compound Name | N'-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboximidamide |
|---|---|
| PubChem CID | 145417842 |
| Molecular Formula | C20H19ClFN5OS |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | N'-[1-amino-3-(3-fluorophenyl)propan-2-yl]-3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboximidamide |
| SMILES | NCC(Cc1cccc(F)c1)/N=C(\N)c1cc2c(s1)C(=O)CCn1ncc(Cl)c1-2 |
| InChI | InChI=1S/C20H19ClFN5OS/c21-15-10-25-27-5-4-16(28)19-14(18(15)27)8-17(29-19)20(24)26-13(9-23)7-11-2-1-3-12(22)6-11/h1-3,6,8,10,13H,4-5,7,9,23H2,(H2,24,26) |
| InChIKey | NXSWDQUFOQLXMU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|