C29H25ClN4O3S — CID 139344282
3-chloro-N-[1-(1,3-dioxoisoindol-2-yl)-4-phenylbutan-2-yl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide (PubChem CID 139344282) has the molecular formula C29H25ClN4O3S and a molecular weight of 545.06 g/mol. Its IUPAC name is 3-chloro-N-[1-(1,3-dioxoisoindol-2-yl)-4-phenylbutan-2-yl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide.
| Compound Name | 3-chloro-N-[1-(1,3-dioxoisoindol-2-yl)-4-phenylbutan-2-yl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 139344282 |
| Molecular Formula | C29H25ClN4O3S |
| Molecular Weight | 545.06 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | 3-chloro-N-[1-(1,3-dioxoisoindol-2-yl)-4-phenylbutan-2-yl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
| SMILES | O=C(NC(CCc1ccccc1)CN1C(=O)c2ccccc2C1=O)c1cc2c(s1)CCCn1ncc(Cl)c1-2 |
| InChI | InChI=1S/C29H25ClN4O3S/c30-23-16-31-34-14-6-11-24-22(26(23)34)15-25(38-24)27(35)32-19(13-12-18-7-2-1-3-8-18)17-33-28(36)20-9-4-5-10-21(20)29(33)37/h1-5,7-10,15-16,19H,6,11-14,17H2,(H,32,35) |
| InChIKey | AZRGPWAVNXMHEA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.06 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|