C22H24ClN3OS — CID 161037082
3-(aminomethyl)-1-(3-chloro-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-4-(2-methylphenyl)butan-1-one (PubChem CID 161037082) has the molecular formula C22H24ClN3OS and a molecular weight of 413.97 g/mol. Its IUPAC name is 3-(aminomethyl)-1-(3-chloro-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-4-(2-methylphenyl)butan-1-one.
| Compound Name | 3-(aminomethyl)-1-(3-chloro-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-4-(2-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 161037082 |
| Molecular Formula | C22H24ClN3OS |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-(aminomethyl)-1-(3-chloro-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-4-(2-methylphenyl)butan-1-one |
| SMILES | Cc1ccccc1CC(CN)CC(=O)c1cc2c(s1)CCCn1ncc(Cl)c1-2 |
| InChI | InChI=1S/C22H24ClN3OS/c1-14-5-2-3-6-16(14)9-15(12-24)10-19(27)21-11-17-20(28-21)7-4-8-26-22(17)18(23)13-25-26/h2-3,5-6,11,13,15H,4,7-10,12,24H2,1H3 |
| InChIKey | ISLLNLJCQOJMNQ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |