C15H15ClN2O2S3 — CID 138556403
ethyl 3'-chlorospiro[1,3-dithiolane-2,9'-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene]-12'-carboxylate (PubChem CID 138556403) has the molecular formula C15H15ClN2O2S3 and a molecular weight of 386.95 g/mol. Its IUPAC name is ethyl 3'-chlorospiro[1,3-dithiolane-2,9'-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene]-12'-carboxylate.
| Compound Name | ethyl 3'-chlorospiro[1,3-dithiolane-2,9'-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene]-12'-carboxylate |
|---|---|
| PubChem CID | 138556403 |
| Molecular Formula | C15H15ClN2O2S3 |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.00 |
| IUPAC Name | ethyl 3'-chlorospiro[1,3-dithiolane-2,9'-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene]-12'-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)C1(CCn3ncc(Cl)c3-2)SCCS1 |
| InChI | InChI=1S/C15H15ClN2O2S3/c1-2-20-14(19)11-7-9-12-10(16)8-17-18(12)4-3-15(13(9)23-11)21-5-6-22-15/h7-8H,2-6H2,1H3 |
| InChIKey | PEKHJJMHXPUWND-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |