C12H9Cl2N3O2 — CID 71742725
ethyl 2-(2,5-dichloro-4-pyridinyl)pyrimidine-5-carboxylate (PubChem CID 71742725) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is ethyl 2-(2,5-dichloro-4-pyridinyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(2,5-dichloro-4-pyridinyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71742725 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | ethyl 2-(2,5-dichloro-4-pyridinyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2cc(Cl)ncc2Cl)nc1 |
| InChI | InChI=1S/C12H9Cl2N3O2/c1-2-19-12(18)7-4-16-11(17-5-7)8-3-10(14)15-6-9(8)13/h3-6H,2H2,1H3 |
| InChIKey | QNPDYGPBDDLZKC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|