C29H21ClFN3O4S — CID 158187474
2-[(2R)-4-(3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-2-[(3-fluorophenyl)methyl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 158187474) has the molecular formula C29H21ClFN3O4S and a molecular weight of 562.02 g/mol. Its IUPAC name is 2-[(2R)-4-(3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-2-[(3-fluorophenyl)methyl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[(2R)-4-(3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-2-[(3-fluorophenyl)methyl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 158187474 |
| Molecular Formula | C29H21ClFN3O4S |
| Molecular Weight | 562.02 g/mol |
| Exact Mass | 561.09 |
| IUPAC Name | 2-[(2R)-4-(3-chloro-9-oxo-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraen-12-yl)-2-[(3-fluorophenyl)methyl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | O=C(C[C@@H](Cc1cccc(F)c1)CN1C(=O)c2ccccc2C1=O)c1cc2c(s1)C(=O)CCn1ncc(Cl)c1-2 |
| InChI | InChI=1S/C29H21ClFN3O4S/c30-22-14-32-34-9-8-23(35)27-21(26(22)34)13-25(39-27)24(36)12-17(10-16-4-3-5-18(31)11-16)15-33-28(37)19-6-1-2-7-20(19)29(33)38/h1-7,11,13-14,17H,8-10,12,15H2/t17-/m1/s1 |
| InChIKey | XVKVJFQCPRELJX-QGZVFWFLSA-N |
| XLogP | 5.72 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.02 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|