C30H23FN4O3S — CID 159601799
12-[(3R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-4-(3-fluorophenyl)butanoyl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-3-carbonitrile (PubChem CID 159601799) has the molecular formula C30H23FN4O3S and a molecular weight of 538.60 g/mol. Its IUPAC name is 12-[(3R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-4-(3-fluorophenyl)butanoyl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-3-carbonitrile.
| Compound Name | 12-[(3R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-4-(3-fluorophenyl)butanoyl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-3-carbonitrile |
|---|---|
| PubChem CID | 159601799 |
| Molecular Formula | C30H23FN4O3S |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.15 |
| IUPAC Name | 12-[(3R)-3-[(1,3-dioxoisoindol-2-yl)methyl]-4-(3-fluorophenyl)butanoyl]-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-3-carbonitrile |
| SMILES | N#Cc1cnn2c1-c1cc(C(=O)C[C@@H](Cc3cccc(F)c3)CN3C(=O)c4ccccc4C3=O)sc1CCC2 |
| InChI | InChI=1S/C30H23FN4O3S/c31-21-6-3-5-18(12-21)11-19(17-34-29(37)22-7-1-2-8-23(22)30(34)38)13-25(36)27-14-24-26(39-27)9-4-10-35-28(24)20(15-32)16-33-35/h1-3,5-8,12,14,16,19H,4,9-11,13,17H2/t19-/m1/s1 |
| InChIKey | UYTIQLBAXSBQNW-LJQANCHMSA-N |
| XLogP | 5.30 |
| TPSA | 96.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|