C22H22F4N4OS — CID 139355488
N-[(2S)-4-amino-1-(3-fluorophenyl)butan-2-yl]-3-(trifluoromethyl)-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide (PubChem CID 139355488) has the molecular formula C22H22F4N4OS and a molecular weight of 466.50 g/mol. Its IUPAC name is N-[(2S)-4-amino-1-(3-fluorophenyl)butan-2-yl]-3-(trifluoromethyl)-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide.
| Compound Name | N-[(2S)-4-amino-1-(3-fluorophenyl)butan-2-yl]-3-(trifluoromethyl)-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
|---|---|
| PubChem CID | 139355488 |
| Molecular Formula | C22H22F4N4OS |
| Molecular Weight | 466.50 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[(2S)-4-amino-1-(3-fluorophenyl)butan-2-yl]-3-(trifluoromethyl)-11-thia-5,6-diazatricyclo[8.3.0.02,6]trideca-1(10),2,4,12-tetraene-12-carboxamide |
| SMILES | NCC[C@H](Cc1cccc(F)c1)NC(=O)c1cc2c(s1)CCCn1ncc(C(F)(F)F)c1-2 |
| InChI | InChI=1S/C22H22F4N4OS/c23-14-4-1-3-13(9-14)10-15(6-7-27)29-21(31)19-11-16-18(32-19)5-2-8-30-20(16)17(12-28-30)22(24,25)26/h1,3-4,9,11-12,15H,2,5-8,10,27H2,(H,29,31)/t15-/m1/s1 |
| InChIKey | OODVGVFIMAZUIN-OAHLLOKOSA-N |
| XLogP | 4.41 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |