C28H24ClN9O3S — CID 90233125
2-[1-[[6-amino-5-(2-pyrazin-2-ylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-4-oxo-3-[3-[2-(sulfinoamino)ethyl]phenyl]quinazoline (PubChem CID 90233125) has the molecular formula C28H24ClN9O3S and a molecular weight of 602.08 g/mol. Its IUPAC name is 2-[1-[[6-amino-5-(2-pyrazin-2-ylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-4-oxo-3-[3-[2-(sulfinoamino)ethyl]phenyl]quinazoline.
| Compound Name | 2-[1-[[6-amino-5-(2-pyrazin-2-ylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-4-oxo-3-[3-[2-(sulfinoamino)ethyl]phenyl]quinazoline |
|---|---|
| PubChem CID | 90233125 |
| Molecular Formula | C28H24ClN9O3S |
| Molecular Weight | 602.08 g/mol |
| Exact Mass | 601.14 |
| IUPAC Name | 2-[1-[[6-amino-5-(2-pyrazin-2-ylethynyl)pyrimidin-4-yl]amino]ethyl]-5-chloro-4-oxo-3-[3-[2-(sulfinoamino)ethyl]phenyl]quinazoline |
| SMILES | CC(Nc1ncnc(N)c1C#Cc1cnccn1)c1nc2cccc(Cl)c2c(=O)n1-c1cccc(CCNS(=O)O)c1 |
| InChI | InChI=1S/C28H24ClN9O3S/c1-17(36-26-21(25(30)33-16-34-26)9-8-19-15-31-12-13-32-19)27-37-23-7-3-6-22(29)24(23)28(39)38(27)20-5-2-4-18(14-20)10-11-35-42(40)41/h2-7,12-17,35H,10-11H2,1H3,(H,40,41)(H3,30,33,34,36) |
| InChIKey | XGUFMHPEMOASEC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 173.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.08 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|