C18H14N4O3 — CID 90233173
1-(5-cyano-4-oxo-3-phenylquinazolin-2-yl)ethylcarbamic acid (PubChem CID 90233173) has the molecular formula C18H14N4O3 and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-(5-cyano-4-oxo-3-phenylquinazolin-2-yl)ethylcarbamic acid.
| Compound Name | 1-(5-cyano-4-oxo-3-phenylquinazolin-2-yl)ethylcarbamic acid |
|---|---|
| PubChem CID | 90233173 |
| Molecular Formula | C18H14N4O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 1-(5-cyano-4-oxo-3-phenylquinazolin-2-yl)ethylcarbamic acid |
| SMILES | CC(NC(=O)O)c1nc2cccc(C#N)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C18H14N4O3/c1-11(20-18(24)25)16-21-14-9-5-6-12(10-19)15(14)17(23)22(16)13-7-3-2-4-8-13/h2-9,11,20H,1H3,(H,24,25) |
| InChIKey | ITGVLLBAVIYXAQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |