C15H14N4O2 — CID 141346036
[(1S)-1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamic acid (PubChem CID 141346036) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is [(1S)-1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamic acid.
| Compound Name | [(1S)-1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamic acid |
|---|---|
| PubChem CID | 141346036 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(1S)-1-(3-phenylimidazo[4,5-b]pyridin-2-yl)ethyl]carbamic acid |
| SMILES | C[C@H](NC(=O)O)c1nc2cccnc2n1-c1ccccc1 |
| InChI | InChI=1S/C15H14N4O2/c1-10(17-15(20)21)13-18-12-8-5-9-16-14(12)19(13)11-6-3-2-4-7-11/h2-10,17H,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | RMXKLASMPJETSL-JTQLQIEISA-N |
| XLogP | 2.75 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |