C21H17IN8O — CID 90236988
2,4-diamino-6-[2-(8-iodo-4-oxo-3-phenylquinazolin-2-yl)ethylamino]pyrimidine-5-carbonitrile (PubChem CID 90236988) has the molecular formula C21H17IN8O and a molecular weight of 524.33 g/mol. Its IUPAC name is 2,4-diamino-6-[2-(8-iodo-4-oxo-3-phenylquinazolin-2-yl)ethylamino]pyrimidine-5-carbonitrile.
| Compound Name | 2,4-diamino-6-[2-(8-iodo-4-oxo-3-phenylquinazolin-2-yl)ethylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 90236988 |
| Molecular Formula | C21H17IN8O |
| Molecular Weight | 524.33 g/mol |
| Exact Mass | 524.06 |
| IUPAC Name | 2,4-diamino-6-[2-(8-iodo-4-oxo-3-phenylquinazolin-2-yl)ethylamino]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1c(N)nc(N)nc1NCCc1nc2c(I)cccc2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C21H17IN8O/c22-15-8-4-7-13-17(15)27-16(30(20(13)31)12-5-2-1-3-6-12)9-10-26-19-14(11-23)18(24)28-21(25)29-19/h1-8H,9-10H2,(H5,24,25,26,28,29) |
| InChIKey | CGBQZULWCYZLIZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 148.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|