C26H21FN4O — CID 90237647
3-[[(4-cyano-2-fluorophenyl)methyl-cyclopropylamino]methyl]-N-(4-cyanophenyl)benzamide (PubChem CID 90237647) has the molecular formula C26H21FN4O and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-[[(4-cyano-2-fluorophenyl)methyl-cyclopropylamino]methyl]-N-(4-cyanophenyl)benzamide.
| Compound Name | 3-[[(4-cyano-2-fluorophenyl)methyl-cyclopropylamino]methyl]-N-(4-cyanophenyl)benzamide |
|---|---|
| PubChem CID | 90237647 |
| Molecular Formula | C26H21FN4O |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 3-[[(4-cyano-2-fluorophenyl)methyl-cyclopropylamino]methyl]-N-(4-cyanophenyl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cccc(CN(Cc3ccc(C#N)cc3F)C3CC3)c2)cc1 |
| InChI | InChI=1S/C26H21FN4O/c27-25-13-19(15-29)4-7-22(25)17-31(24-10-11-24)16-20-2-1-3-21(12-20)26(32)30-23-8-5-18(14-28)6-9-23/h1-9,12-13,24H,10-11,16-17H2,(H,30,32) |
| InChIKey | LQBNRIXZKAOYDR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 79.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |