C11H21NOSi — CID 90238953
cyclobutyl-(4,4-dimethyl-1,4-azasilinan-1-yl)methanone (PubChem CID 90238953) has the molecular formula C11H21NOSi and a molecular weight of 211.38 g/mol. Its IUPAC name is cyclobutyl-(4,4-dimethyl-1,4-azasilinan-1-yl)methanone.
| Compound Name | cyclobutyl-(4,4-dimethyl-1,4-azasilinan-1-yl)methanone |
|---|---|
| PubChem CID | 90238953 |
| Molecular Formula | C11H21NOSi |
| Molecular Weight | 211.38 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | cyclobutyl-(4,4-dimethyl-1,4-azasilinan-1-yl)methanone |
| SMILES | C[Si]1(C)CCN(C(=O)C2CCC2)CC1 |
| InChI | InChI=1S/C11H21NOSi/c1-14(2)8-6-12(7-9-14)11(13)10-4-3-5-10/h10H,3-9H2,1-2H3 |
| InChIKey | YBVWPXYGMSQNHC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|