C21H15F2N3O — CID 90241589
N'-(4-cyanophenyl)-3-[(2,3-difluorophenyl)methoxy]benzenecarboximidamide (PubChem CID 90241589) has the molecular formula C21H15F2N3O and a molecular weight of 363.37 g/mol. Its IUPAC name is N'-(4-cyanophenyl)-3-[(2,3-difluorophenyl)methoxy]benzenecarboximidamide.
| Compound Name | N'-(4-cyanophenyl)-3-[(2,3-difluorophenyl)methoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 90241589 |
| Molecular Formula | C21H15F2N3O |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | N'-(4-cyanophenyl)-3-[(2,3-difluorophenyl)methoxy]benzenecarboximidamide |
| SMILES | N#Cc1ccc(/N=C(\N)c2cccc(OCc3cccc(F)c3F)c2)cc1 |
| InChI | InChI=1S/C21H15F2N3O/c22-19-6-2-4-16(20(19)23)13-27-18-5-1-3-15(11-18)21(25)26-17-9-7-14(12-24)8-10-17/h1-11H,13H2,(H2,25,26) |
| InChIKey | KOGUPNFIOSOPNA-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|