About 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate
1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate (PubChem CID 90241959) has the molecular formula C7H19NO6S
and a molecular weight of 245.30 g/mol. Its IUPAC name is 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate.
Molecular Properties
| Compound Name | 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate |
| PubChem CID | 90241959 |
| Molecular Formula | C7H19NO6S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate |
| SMILES | CC(O)C(O)[N+](C)(C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H16NO2.CH4O4S/c1-5(8)6(9)7(2,3)4;1-5-6(2,3)4/h5-6,8-9H,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MEIUOBFOVXBENF-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate?
The IUPAC name of 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate (CID 90241959) is 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate.
What is the SMILES notation for 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate?
The canonical SMILES for 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate is CC(O)C(O)[N+](C)(C)C.COS(=O)(=O)[O-].
What is the InChIKey of 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate?
The InChIKey is MEIUOBFOVXBENF-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H16NO2.CH4O4S/c1-5(8)6(9)7(2,3)4;1-5-6(2,3)4/h5-6,8-9H,1-4H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate?
1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate has a molecular weight of 245.30 g/mol, XLogP of -1.52, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate is sourced from PubChem (CID 90241959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).