C7H19NO6S — CID 90241959
1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate (PubChem CID 90241959) has the molecular formula C7H19NO6S and a molecular weight of 245.30 g/mol. Its IUPAC name is 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate.
| Compound Name | 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate |
|---|---|
| PubChem CID | 90241959 |
| Molecular Formula | C7H19NO6S |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 1,2-dihydroxypropyl(trimethyl)azanium;methyl sulfate |
| SMILES | CC(O)C(O)[N+](C)(C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H16NO2.CH4O4S/c1-5(8)6(9)7(2,3)4;1-5-6(2,3)4/h5-6,8-9H,1-4H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | MEIUOBFOVXBENF-UHFFFAOYSA-M |
| XLogP | -1.52 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|