C25H19BClFN4O2 — CID 90243742
CID 90243742 (PubChem CID 90243742) has the molecular formula C25H19BClFN4O2 and a molecular weight of 472.72 g/mol.
| Compound Name | CID 90243742 |
|---|---|
| PubChem CID | 90243742 |
| Molecular Formula | C25H19BClFN4O2 |
| Molecular Weight | 472.72 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | — |
| SMILES | [B]Cc1nc2c(C(=O)Nc3cccc(C=C)c3C)cc(NC(=O)c3ccc(F)cc3Cl)cc2[nH]1 |
| InChI | InChI=1S/C25H19BClFN4O2/c1-3-14-5-4-6-20(13(14)2)31-25(34)18-10-16(11-21-23(18)32-22(12-26)30-21)29-24(33)17-8-7-15(28)9-19(17)27/h3-11H,1,12H2,2H3,(H,29,33)(H,30,32)(H,31,34) |
| InChIKey | LLBPOBSVDZAZSH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.72 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|