C12H16INO — CID 90244476
7-tert-butyl-5-iodo-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 90244476) has the molecular formula C12H16INO and a molecular weight of 317.17 g/mol. Its IUPAC name is 7-tert-butyl-5-iodo-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 7-tert-butyl-5-iodo-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 90244476 |
| Molecular Formula | C12H16INO |
| Molecular Weight | 317.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 7-tert-butyl-5-iodo-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC(C)(C)c1cc(I)c2c(c1)OCCN2 |
| InChI | InChI=1S/C12H16INO/c1-12(2,3)8-6-9(13)11-10(7-8)15-5-4-14-11/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | HAGNLKPVKKRBJH-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.17 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|