C7H14N2 — CID 90244936
1-methyl-2-methylidene-1,4-diazepane (PubChem CID 90244936) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 1-methyl-2-methylidene-1,4-diazepane.
| Compound Name | 1-methyl-2-methylidene-1,4-diazepane |
|---|---|
| PubChem CID | 90244936 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1-methyl-2-methylidene-1,4-diazepane |
| SMILES | C=C1CNCCCN1C |
| InChI | InChI=1S/C7H14N2/c1-7-6-8-4-3-5-9(7)2/h8H,1,3-6H2,2H3 |
| InChIKey | NEUCQMXEYGAOCZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |