C18H34F3N5O — CID 90245579
N-[3-(dimethylamino)propyl]-3-[(E)-2-[4-[methyl(2,2,2-trifluoroethyl)amino]butan-2-ylamino]prop-1-enyl]iminopropanamide (PubChem CID 90245579) has the molecular formula C18H34F3N5O and a molecular weight of 393.50 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-3-[(E)-2-[4-[methyl(2,2,2-trifluoroethyl)amino]butan-2-ylamino]prop-1-enyl]iminopropanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-3-[(E)-2-[4-[methyl(2,2,2-trifluoroethyl)amino]butan-2-ylamino]prop-1-enyl]iminopropanamide |
|---|---|
| PubChem CID | 90245579 |
| Molecular Formula | C18H34F3N5O |
| Molecular Weight | 393.50 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-3-[(E)-2-[4-[methyl(2,2,2-trifluoroethyl)amino]butan-2-ylamino]prop-1-enyl]iminopropanamide |
| SMILES | C/C(=C\N=C\CC(=O)NCCCN(C)C)NC(C)CCN(C)CC(F)(F)F |
| InChI | InChI=1S/C18H34F3N5O/c1-15(8-12-26(5)14-18(19,20)21)24-16(2)13-22-10-7-17(27)23-9-6-11-25(3)4/h10,13,15,24H,6-9,11-12,14H2,1-5H3,(H,23,27)/b16-13+,22-10+ |
| InChIKey | WSOGTFQIFFALFU-YHLNPCLLSA-N |
| XLogP | 2.24 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|