C14H26N4O2 — CID 90245596
3-[(E)-2-[4-[acetyl(methyl)amino]butan-2-ylamino]prop-1-enyl]imino-N-methylpropanamide (PubChem CID 90245596) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 3-[(E)-2-[4-[acetyl(methyl)amino]butan-2-ylamino]prop-1-enyl]imino-N-methylpropanamide.
| Compound Name | 3-[(E)-2-[4-[acetyl(methyl)amino]butan-2-ylamino]prop-1-enyl]imino-N-methylpropanamide |
|---|---|
| PubChem CID | 90245596 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-[(E)-2-[4-[acetyl(methyl)amino]butan-2-ylamino]prop-1-enyl]imino-N-methylpropanamide |
| SMILES | CNC(=O)C/C=N/C=C(\C)NC(C)CCN(C)C(C)=O |
| InChI | InChI=1S/C14H26N4O2/c1-11(7-9-18(5)13(3)19)17-12(2)10-16-8-6-14(20)15-4/h8,10-11,17H,6-7,9H2,1-5H3,(H,15,20)/b12-10+,16-8+ |
| InChIKey | IKPWJNXSMDVNCJ-HVLRKUJGSA-N |
| XLogP | 0.90 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|