C8H18N2O3 — CID 90248628
N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-2-methoxyacetamide (PubChem CID 90248628) has the molecular formula C8H18N2O3 and a molecular weight of 190.24 g/mol. Its IUPAC name is N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-2-methoxyacetamide.
| Compound Name | N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 90248628 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | N-[(2R)-3-(dimethylamino)-2-hydroxypropyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC[C@@H](O)CN(C)C |
| InChI | InChI=1S/C8H18N2O3/c1-10(2)5-7(11)4-9-8(12)6-13-3/h7,11H,4-6H2,1-3H3,(H,9,12)/t7-/m1/s1 |
| InChIKey | PZFULWYHILGRFY-SSDOTTSWSA-N |
| XLogP | -1.33 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |