C7H16N2O3 — CID 90248832
N-[(2S)-2-hydroxy-3-(methylamino)propyl]-2-methoxyacetamide (PubChem CID 90248832) has the molecular formula C7H16N2O3 and a molecular weight of 176.22 g/mol. Its IUPAC name is N-[(2S)-2-hydroxy-3-(methylamino)propyl]-2-methoxyacetamide.
| Compound Name | N-[(2S)-2-hydroxy-3-(methylamino)propyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 90248832 |
| Molecular Formula | C7H16N2O3 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | N-[(2S)-2-hydroxy-3-(methylamino)propyl]-2-methoxyacetamide |
| SMILES | CNC[C@H](O)CNC(=O)COC |
| InChI | InChI=1S/C7H16N2O3/c1-8-3-6(10)4-9-7(11)5-12-2/h6,8,10H,3-5H2,1-2H3,(H,9,11)/t6-/m0/s1 |
| InChIKey | RGZDOLRPPKXBJB-LURJTMIESA-N |
| XLogP | -1.67 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |