C20H17N5O3 — CID 90248997
CID 90248997 (PubChem CID 90248997) has the molecular formula C20H17N5O3 and a molecular weight of 375.39 g/mol.
| Compound Name | CID 90248997 |
|---|---|
| PubChem CID | 90248997 |
| Molecular Formula | C20H17N5O3 |
| Molecular Weight | 375.39 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc3c(c2)C2(COC(N)=N2)C2(CC2)CO3)nc1 |
| InChI | InChI=1S/C20H17N5O3/c21-8-12-1-3-15(23-9-12)17(26)24-13-2-4-16-14(7-13)20(11-28-18(22)25-20)19(5-6-19)10-27-16/h1-4,7,9H,5-6,10-11H2,(H2,22,25)(H,24,26) |
| InChIKey | FCSDLAQZROWWFP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 122.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |