C20H17FN4O5 — CID 90235599
CID 90235599 (PubChem CID 90235599) has the molecular formula C20H17FN4O5 and a molecular weight of 412.38 g/mol.
| Compound Name | CID 90235599 |
|---|---|
| PubChem CID | 90235599 |
| Molecular Formula | C20H17FN4O5 |
| Molecular Weight | 412.38 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | — |
| SMILES | O=C(O)NC1=NC2(CO1)c1cc(NC(=O)c3ccc(F)cn3)ccc1OCC21CC1 |
| InChI | InChI=1S/C20H17FN4O5/c21-11-1-3-14(22-8-11)16(26)23-12-2-4-15-13(7-12)20(19(5-6-19)9-29-15)10-30-17(25-20)24-18(27)28/h1-4,7-8H,5-6,9-10H2,(H,23,26)(H,24,25)(H,27,28) |
| InChIKey | FSJJOQYUHYHOIK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |