C19H21FN4O2S — CID 143933559
N-[4-[2-(aminomethylsulfanyl)ethyl]-4-(methylideneamino)-2,3-dihydrochromen-6-yl]-5-fluoropyridine-2-carboxamide (PubChem CID 143933559) has the molecular formula C19H21FN4O2S and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[4-[2-(aminomethylsulfanyl)ethyl]-4-(methylideneamino)-2,3-dihydrochromen-6-yl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[2-(aminomethylsulfanyl)ethyl]-4-(methylideneamino)-2,3-dihydrochromen-6-yl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 143933559 |
| Molecular Formula | C19H21FN4O2S |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N-[4-[2-(aminomethylsulfanyl)ethyl]-4-(methylideneamino)-2,3-dihydrochromen-6-yl]-5-fluoropyridine-2-carboxamide |
| SMILES | C=NC1(CCSCN)CCOc2ccc(NC(=O)c3ccc(F)cn3)cc21 |
| InChI | InChI=1S/C19H21FN4O2S/c1-22-19(7-9-27-12-21)6-8-26-17-5-3-14(10-15(17)19)24-18(25)16-4-2-13(20)11-23-16/h2-5,10-11H,1,6-9,12,21H2,(H,24,25) |
| InChIKey | SSRNQTGIXOWMAB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|