C14H19NO5 — CID 90253466
4-pyridin-3-yl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butan-2-one (PubChem CID 90253466) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-pyridin-3-yl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butan-2-one.
| Compound Name | 4-pyridin-3-yl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butan-2-one |
|---|---|
| PubChem CID | 90253466 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-pyridin-3-yl-1-[(3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]butan-2-one |
| SMILES | O=C(CCc1cccnc1)CC1OC[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H19NO5/c16-10(4-3-9-2-1-5-15-7-9)6-12-14(19)13(18)11(17)8-20-12/h1-2,5,7,11-14,17-19H,3-4,6,8H2/t11-,12?,13+,14+/m1/s1 |
| InChIKey | HLYLAXMCGAVKFX-KRCVMZOZSA-N |
| XLogP | -0.55 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |